C11H12BrF3O — CID 107723472
2-bromo-1,3-dimethyl-5-(3,3,3-trifluoropropoxy)benzene (PubChem CID 107723472) has the molecular formula C11H12BrF3O and a molecular weight of 297.11 g/mol. Its IUPAC name is 2-bromo-1,3-dimethyl-5-(3,3,3-trifluoropropoxy)benzene.
| Compound Name | 2-bromo-1,3-dimethyl-5-(3,3,3-trifluoropropoxy)benzene |
|---|---|
| PubChem CID | 107723472 |
| Molecular Formula | C11H12BrF3O |
| Molecular Weight | 297.11 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 2-bromo-1,3-dimethyl-5-(3,3,3-trifluoropropoxy)benzene |
| SMILES | Cc1cc(OCCC(F)(F)F)cc(C)c1Br |
| InChI | InChI=1S/C11H12BrF3O/c1-7-5-9(6-8(2)10(7)12)16-4-3-11(13,14)15/h5-6H,3-4H2,1-2H3 |
| InChIKey | ONJXFZZJDHVMJU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.11 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |