C12H17BrO2 — CID 129387597
(2S)-4-(4-bromo-3,5-dimethylphenoxy)butan-2-ol (PubChem CID 129387597) has the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. Its IUPAC name is (2S)-4-(4-bromo-3,5-dimethylphenoxy)butan-2-ol.
| Compound Name | (2S)-4-(4-bromo-3,5-dimethylphenoxy)butan-2-ol |
|---|---|
| PubChem CID | 129387597 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | (2S)-4-(4-bromo-3,5-dimethylphenoxy)butan-2-ol |
| SMILES | Cc1cc(OCC[C@H](C)O)cc(C)c1Br |
| InChI | InChI=1S/C12H17BrO2/c1-8-6-11(7-9(2)12(8)13)15-5-4-10(3)14/h6-7,10,14H,4-5H2,1-3H3/t10-/m0/s1 |
| InChIKey | PQNYRTICMNLEIQ-JTQLQIEISA-N |
| XLogP | 3.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |