C14H21BrOS — CID 107727257
5-(4-bromo-3,5-dimethylphenoxy)-3-methylpentane-1-thiol (PubChem CID 107727257) has the molecular formula C14H21BrOS and a molecular weight of 317.29 g/mol. Its IUPAC name is 5-(4-bromo-3,5-dimethylphenoxy)-3-methylpentane-1-thiol.
| Compound Name | 5-(4-bromo-3,5-dimethylphenoxy)-3-methylpentane-1-thiol |
|---|---|
| PubChem CID | 107727257 |
| Molecular Formula | C14H21BrOS |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 5-(4-bromo-3,5-dimethylphenoxy)-3-methylpentane-1-thiol |
| SMILES | Cc1cc(OCCC(C)CCS)cc(C)c1Br |
| InChI | InChI=1S/C14H21BrOS/c1-10(5-7-17)4-6-16-13-8-11(2)14(15)12(3)9-13/h8-10,17H,4-7H2,1-3H3 |
| InChIKey | UYOOTMWXYXZBPI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|