C10H10BrNO — CID 22688454
2-(4-bromo-3,5-dimethylphenoxy)acetonitrile (PubChem CID 22688454) has the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylphenoxy)acetonitrile.
| Compound Name | 2-(4-bromo-3,5-dimethylphenoxy)acetonitrile |
|---|---|
| PubChem CID | 22688454 |
| Molecular Formula | C10H10BrNO |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylphenoxy)acetonitrile |
| SMILES | Cc1cc(OCC#N)cc(C)c1Br |
| InChI | InChI=1S/C10H10BrNO/c1-7-5-9(13-4-3-12)6-8(2)10(7)11/h5-6H,4H2,1-2H3 |
| InChIKey | ODEGONCELYZGPA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |