C14H22ClNO — CID 112509062
4-(4-chloro-3,5-dimethylphenoxy)-N,2-dimethylbutan-1-amine (PubChem CID 112509062) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylphenoxy)-N,2-dimethylbutan-1-amine.
| Compound Name | 4-(4-chloro-3,5-dimethylphenoxy)-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 112509062 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylphenoxy)-N,2-dimethylbutan-1-amine |
| SMILES | CNCC(C)CCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C14H22ClNO/c1-10(9-16-4)5-6-17-13-7-11(2)14(15)12(3)8-13/h7-8,10,16H,5-6,9H2,1-4H3 |
| InChIKey | BPSAWLCHWQTXLT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |