C13H19BrO3 — CID 144562870
3-(4-bromo-3,5-dimethylphenoxy)propanoic acid;ethane (PubChem CID 144562870) has the molecular formula C13H19BrO3 and a molecular weight of 303.20 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylphenoxy)propanoic acid;ethane.
| Compound Name | 3-(4-bromo-3,5-dimethylphenoxy)propanoic acid;ethane |
|---|---|
| PubChem CID | 144562870 |
| Molecular Formula | C13H19BrO3 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylphenoxy)propanoic acid;ethane |
| SMILES | CC.Cc1cc(OCCC(=O)O)cc(C)c1Br |
| InChI | InChI=1S/C11H13BrO3.C2H6/c1-7-5-9(6-8(2)11(7)12)15-4-3-10(13)14;1-2/h5-6H,3-4H2,1-2H3,(H,13,14);1-2H3 |
| InChIKey | QVMALERJHJYMND-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |