C24H31Br2NO6 — CID 158348793
3-(4-bromo-3,5-dimethylphenoxy)-N-methoxy-N-methylpropanamide;3-(4-bromo-3,5-dimethylphenoxy)propanoic acid (PubChem CID 158348793) has the molecular formula C24H31Br2NO6 and a molecular weight of 589.32 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylphenoxy)-N-methoxy-N-methylpropanamide;3-(4-bromo-3,5-dimethylphenoxy)propanoic acid.
| Compound Name | 3-(4-bromo-3,5-dimethylphenoxy)-N-methoxy-N-methylpropanamide;3-(4-bromo-3,5-dimethylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 158348793 |
| Molecular Formula | C24H31Br2NO6 |
| Molecular Weight | 589.32 g/mol |
| Exact Mass | 587.05 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylphenoxy)-N-methoxy-N-methylpropanamide;3-(4-bromo-3,5-dimethylphenoxy)propanoic acid |
| SMILES | CON(C)C(=O)CCOc1cc(C)c(Br)c(C)c1.Cc1cc(OCCC(=O)O)cc(C)c1Br |
| InChI | InChI=1S/C13H18BrNO3.C11H13BrO3/c1-9-7-11(8-10(2)13(9)14)18-6-5-12(16)15(3)17-4;1-7-5-9(6-8(2)11(7)12)15-4-3-10(13)14/h7-8H,5-6H2,1-4H3;5-6H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | GSBFRTXDMOAHAE-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.32 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|