C15H23NO2 — CID 60731406
3-(3,5-dimethylphenoxy)-N,N-diethylpropanamide (PubChem CID 60731406) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 3-(3,5-dimethylphenoxy)-N,N-diethylpropanamide.
| Compound Name | 3-(3,5-dimethylphenoxy)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 60731406 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 3-(3,5-dimethylphenoxy)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C15H23NO2/c1-5-16(6-2)15(17)7-8-18-14-10-12(3)9-13(4)11-14/h9-11H,5-8H2,1-4H3 |
| InChIKey | XMVWQPNYPHWASF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |