C13H18O — CID 114477410
1,3-dimethyl-5-(3-methylbut-3-enoxy)benzene (PubChem CID 114477410) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3-methylbut-3-enoxy)benzene.
| Compound Name | 1,3-dimethyl-5-(3-methylbut-3-enoxy)benzene |
|---|---|
| PubChem CID | 114477410 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 1,3-dimethyl-5-(3-methylbut-3-enoxy)benzene |
| SMILES | C=C(C)CCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C13H18O/c1-10(2)5-6-14-13-8-11(3)7-12(4)9-13/h7-9H,1,5-6H2,2-4H3 |
| InChIKey | XBQBBABDSNNVCU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|