About 1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine
1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine (PubChem CID 170855062) has the molecular formula C16H21BrF3NO
and a molecular weight of 380.25 g/mol. Its IUPAC name is 1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine.
Molecular Properties
| Compound Name | 1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine |
| PubChem CID | 170855062 |
| Molecular Formula | C16H21BrF3NO |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine |
| SMILES | Cc1cc(OCCN2CCC(C(F)(F)F)CC2)cc(C)c1Br |
| InChI | InChI=1S/C16H21BrF3NO/c1-11-9-14(10-12(2)15(11)17)22-8-7-21-5-3-13(4-6-21)16(18,19)20/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | VRRPCKFFSVEUIS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine?
The IUPAC name of 1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine (CID 170855062) is 1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine.
What is the SMILES notation for 1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine?
The canonical SMILES for 1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine is Cc1cc(OCCN2CCC(C(F)(F)F)CC2)cc(C)c1Br.
What is the InChIKey of 1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine?
The InChIKey is VRRPCKFFSVEUIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21BrF3NO/c1-11-9-14(10-12(2)15(11)17)22-8-7-21-5-3-13(4-6-21)16(18,19)20/h9-10,13H,3-8H2,1-2H3.
What are the key properties of 1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine?
1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine has a molecular weight of 380.25 g/mol, XLogP of 4.72, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-bromo-3,5-dimethylphenoxy)ethyl]-4-(trifluoromethyl)piperidine is sourced from PubChem (CID 170855062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).