C20H21BrF3NO — CID 172648004
1-[(3-bromo-5-phenylmethoxyphenyl)methyl]-4-(trifluoromethyl)piperidine (PubChem CID 172648004) has the molecular formula C20H21BrF3NO and a molecular weight of 428.29 g/mol. Its IUPAC name is 1-[(3-bromo-5-phenylmethoxyphenyl)methyl]-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[(3-bromo-5-phenylmethoxyphenyl)methyl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 172648004 |
| Molecular Formula | C20H21BrF3NO |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 1-[(3-bromo-5-phenylmethoxyphenyl)methyl]-4-(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)C1CCN(Cc2cc(Br)cc(OCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C20H21BrF3NO/c21-18-10-16(13-25-8-6-17(7-9-25)20(22,23)24)11-19(12-18)26-14-15-4-2-1-3-5-15/h1-5,10-12,17H,6-9,13-14H2 |
| InChIKey | CHRHVRXEYSHHBK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |