C14H14BrF6N — CID 172647999
1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethyl)piperidine (PubChem CID 172647999) has the molecular formula C14H14BrF6N and a molecular weight of 390.17 g/mol. Its IUPAC name is 1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 172647999 |
| Molecular Formula | C14H14BrF6N |
| Molecular Weight | 390.17 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]-4-(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)c1cc(Br)cc(CN2CCC(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C14H14BrF6N/c15-12-6-9(5-11(7-12)14(19,20)21)8-22-3-1-10(2-4-22)13(16,17)18/h5-7,10H,1-4,8H2 |
| InChIKey | VAPSXMBRYYBTEM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.17 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |