C13H15BrF3NO — CID 172647841
(3R)-1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]-3-methoxypyrrolidine (PubChem CID 172647841) has the molecular formula C13H15BrF3NO and a molecular weight of 338.17 g/mol. Its IUPAC name is (3R)-1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]-3-methoxypyrrolidine.
| Compound Name | (3R)-1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]-3-methoxypyrrolidine |
|---|---|
| PubChem CID | 172647841 |
| Molecular Formula | C13H15BrF3NO |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | (3R)-1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]-3-methoxypyrrolidine |
| SMILES | CO[C@@H]1CCN(Cc2cc(Br)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H15BrF3NO/c1-19-12-2-3-18(8-12)7-9-4-10(13(15,16)17)6-11(14)5-9/h4-6,12H,2-3,7-8H2,1H3/t12-/m1/s1 |
| InChIKey | NPHPNOKMEXJHKN-GFCCVEGCSA-N |
| XLogP | 3.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |