C14H18BrF3N2 — CID 138985674
1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]-4-ethylpiperazine (PubChem CID 138985674) has the molecular formula C14H18BrF3N2 and a molecular weight of 351.21 g/mol. Its IUPAC name is 1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]-4-ethylpiperazine.
| Compound Name | 1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]-4-ethylpiperazine |
|---|---|
| PubChem CID | 138985674 |
| Molecular Formula | C14H18BrF3N2 |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 1-[[3-bromo-5-(trifluoromethyl)phenyl]methyl]-4-ethylpiperazine |
| SMILES | CCN1CCN(Cc2cc(Br)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C14H18BrF3N2/c1-2-19-3-5-20(6-4-19)10-11-7-12(14(16,17)18)9-13(15)8-11/h7-9H,2-6,10H2,1H3 |
| InChIKey | GNXCZLSWRFAHQG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |