C19H24F6N2O — CID 90903203
1-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]piperazin-1-yl]hexan-1-one (PubChem CID 90903203) has the molecular formula C19H24F6N2O and a molecular weight of 410.40 g/mol. Its IUPAC name is 1-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]piperazin-1-yl]hexan-1-one.
| Compound Name | 1-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 90903203 |
| Molecular Formula | C19H24F6N2O |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]piperazin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCN(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H24F6N2O/c1-2-3-4-5-17(28)27-8-6-26(7-9-27)13-14-10-15(18(20,21)22)12-16(11-14)19(23,24)25/h10-12H,2-9,13H2,1H3 |
| InChIKey | WJWSNDPNPJWKOQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|