C18H26F3N3O — CID 119838199
4-(methylamino)-1-[4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-1-yl]butan-1-one (PubChem CID 119838199) has the molecular formula C18H26F3N3O and a molecular weight of 357.42 g/mol. Its IUPAC name is 4-(methylamino)-1-[4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | 4-(methylamino)-1-[4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 119838199 |
| Molecular Formula | C18H26F3N3O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 4-(methylamino)-1-[4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-1-yl]butan-1-one |
| SMILES | CNCCCC(=O)N1CCCN(Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H26F3N3O/c1-22-9-2-4-17(25)24-11-3-10-23(12-13-24)14-15-5-7-16(8-6-15)18(19,20)21/h5-8,22H,2-4,9-14H2,1H3 |
| InChIKey | CWYKWZKKDIROSP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|