C18H28Cl2F3N3O2 — CID 119838229
2-(2-methoxyethylamino)-1-[4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-1-yl]ethanone;dihydrochloride (PubChem CID 119838229) has the molecular formula C18H28Cl2F3N3O2 and a molecular weight of 446.34 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-1-[4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-1-yl]ethanone;dihydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-1-[4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119838229 |
| Molecular Formula | C18H28Cl2F3N3O2 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-(2-methoxyethylamino)-1-[4-[[4-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-1-yl]ethanone;dihydrochloride |
| SMILES | COCCNCC(=O)N1CCCN(Cc2ccc(C(F)(F)F)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C18H26F3N3O2.2ClH/c1-26-12-7-22-13-17(25)24-9-2-8-23(10-11-24)14-15-3-5-16(6-4-15)18(19,20)21;;/h3-6,22H,2,7-14H2,1H3;2*1H |
| InChIKey | JNIPIMAWBOJIOZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|