C10H10ClF3O3S — CID 64554785
2-methyl-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride (PubChem CID 64554785) has the molecular formula C10H10ClF3O3S and a molecular weight of 302.70 g/mol. Its IUPAC name is 2-methyl-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride.
| Compound Name | 2-methyl-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 64554785 |
| Molecular Formula | C10H10ClF3O3S |
| Molecular Weight | 302.70 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 2-methyl-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride |
| SMILES | Cc1cc(OCCC(F)(F)F)ccc1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H10ClF3O3S/c1-7-6-8(17-5-4-10(12,13)14)2-3-9(7)18(11,15)16/h2-3,6H,4-5H2,1H3 |
| InChIKey | KAMMKAOGAPXWNZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |