C10H12ClFO3S — CID 81106046
4-(3-fluoropropoxy)-2-methylbenzenesulfonyl chloride (PubChem CID 81106046) has the molecular formula C10H12ClFO3S and a molecular weight of 266.72 g/mol. Its IUPAC name is 4-(3-fluoropropoxy)-2-methylbenzenesulfonyl chloride.
| Compound Name | 4-(3-fluoropropoxy)-2-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 81106046 |
| Molecular Formula | C10H12ClFO3S |
| Molecular Weight | 266.72 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 4-(3-fluoropropoxy)-2-methylbenzenesulfonyl chloride |
| SMILES | Cc1cc(OCCCF)ccc1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H12ClFO3S/c1-8-7-9(15-6-2-5-12)3-4-10(8)16(11,13)14/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | WFVGCDAEUVUUJT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.72 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|