C9H12FNO3S — CID 80694123
4-(2-fluoroethoxy)-2-methylbenzenesulfonamide (PubChem CID 80694123) has the molecular formula C9H12FNO3S and a molecular weight of 233.26 g/mol. Its IUPAC name is 4-(2-fluoroethoxy)-2-methylbenzenesulfonamide.
| Compound Name | 4-(2-fluoroethoxy)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 80694123 |
| Molecular Formula | C9H12FNO3S |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 4-(2-fluoroethoxy)-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(OCCF)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C9H12FNO3S/c1-7-6-8(14-5-4-10)2-3-9(7)15(11,12)13/h2-3,6H,4-5H2,1H3,(H2,11,12,13) |
| InChIKey | XVQLDQGHNZKEFG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |