C10H12ClNO3S — CID 82914363
4-[(E)-3-chloroprop-2-enoxy]-2-methylbenzenesulfonamide (PubChem CID 82914363) has the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. Its IUPAC name is 4-[(E)-3-chloroprop-2-enoxy]-2-methylbenzenesulfonamide.
| Compound Name | 4-[(E)-3-chloroprop-2-enoxy]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 82914363 |
| Molecular Formula | C10H12ClNO3S |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 4-[(E)-3-chloroprop-2-enoxy]-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(OC/C=C/Cl)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C10H12ClNO3S/c1-8-7-9(15-6-2-5-11)3-4-10(8)16(12,13)14/h2-5,7H,6H2,1H3,(H2,12,13,14)/b5-2+ |
| InChIKey | DSEQMEBXAXLEPJ-GORDUTHDSA-N |
| XLogP | 1.77 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |