C10H11N3O4S — CID 82914582
2-methyl-4-(1,2,4-oxadiazol-3-ylmethoxy)benzenesulfonamide (PubChem CID 82914582) has the molecular formula C10H11N3O4S and a molecular weight of 269.28 g/mol. Its IUPAC name is 2-methyl-4-(1,2,4-oxadiazol-3-ylmethoxy)benzenesulfonamide.
| Compound Name | 2-methyl-4-(1,2,4-oxadiazol-3-ylmethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 82914582 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 2-methyl-4-(1,2,4-oxadiazol-3-ylmethoxy)benzenesulfonamide |
| SMILES | Cc1cc(OCc2ncon2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C10H11N3O4S/c1-7-4-8(2-3-9(7)18(11,14)15)16-5-10-12-6-17-13-10/h2-4,6H,5H2,1H3,(H2,11,14,15) |
| InChIKey | HUHZHAVBBDGDPI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |