C10H9FN2O2 — CID 107171304
3-[(3-fluoro-4-methylphenoxy)methyl]-1,2,4-oxadiazole (PubChem CID 107171304) has the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. Its IUPAC name is 3-[(3-fluoro-4-methylphenoxy)methyl]-1,2,4-oxadiazole.
| Compound Name | 3-[(3-fluoro-4-methylphenoxy)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 107171304 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 3-[(3-fluoro-4-methylphenoxy)methyl]-1,2,4-oxadiazole |
| SMILES | Cc1ccc(OCc2ncon2)cc1F |
| InChI | InChI=1S/C10H9FN2O2/c1-7-2-3-8(4-9(7)11)14-5-10-12-6-15-13-10/h2-4,6H,5H2,1H3 |
| InChIKey | OTXQPLIBUULFAW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |