About 3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol
3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol (PubChem CID 107679961) has the molecular formula C10H10N2O3
and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol.
Molecular Properties
| Compound Name | 3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol |
| PubChem CID | 107679961 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol |
| SMILES | Cc1cc(O)cc(OCc2ncon2)c1 |
| InChI | InChI=1S/C10H10N2O3/c1-7-2-8(13)4-9(3-7)14-5-10-11-6-15-12-10/h2-4,6,13H,5H2,1H3 |
| InChIKey | MIDKNFFOXVMRIM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol?
The IUPAC name of 3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol (CID 107679961) is 3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol.
What is the SMILES notation for 3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol?
The canonical SMILES for 3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol is Cc1cc(O)cc(OCc2ncon2)c1.
What is the InChIKey of 3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol?
The InChIKey is MIDKNFFOXVMRIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3/c1-7-2-8(13)4-9(3-7)14-5-10-11-6-15-12-10/h2-4,6,13H,5H2,1H3.
What are the key properties of 3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol?
3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol has a molecular weight of 206.20 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-(1,2,4-oxadiazol-3-ylmethoxy)phenol is sourced from PubChem (CID 107679961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).