C16H25BrN2O — CID 107724712
6-(4-bromo-3,5-dimethylphenoxy)-2,2-dimethylhexanimidamide (PubChem CID 107724712) has the molecular formula C16H25BrN2O and a molecular weight of 341.29 g/mol. Its IUPAC name is 6-(4-bromo-3,5-dimethylphenoxy)-2,2-dimethylhexanimidamide.
| Compound Name | 6-(4-bromo-3,5-dimethylphenoxy)-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 107724712 |
| Molecular Formula | C16H25BrN2O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 6-(4-bromo-3,5-dimethylphenoxy)-2,2-dimethylhexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCOc1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C16H25BrN2O/c1-11-9-13(10-12(2)14(11)17)20-8-6-5-7-16(3,4)15(18)19/h9-10H,5-8H2,1-4H3,(H3,18,19) |
| InChIKey | ZCFPKGYGLSBDAX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|