C18H30N2O — CID 106712401
2,2-dimethyl-6-(2-methyl-5-propan-2-ylphenoxy)hexanimidamide (PubChem CID 106712401) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2-methyl-5-propan-2-ylphenoxy)hexanimidamide.
| Compound Name | 2,2-dimethyl-6-(2-methyl-5-propan-2-ylphenoxy)hexanimidamide |
|---|---|
| PubChem CID | 106712401 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 2,2-dimethyl-6-(2-methyl-5-propan-2-ylphenoxy)hexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCOc1cc(C(C)C)ccc1C |
| InChI | InChI=1S/C18H30N2O/c1-13(2)15-9-8-14(3)16(12-15)21-11-7-6-10-18(4,5)17(19)20/h8-9,12-13H,6-7,10-11H2,1-5H3,(H3,19,20) |
| InChIKey | AAOWUYFRAMUQLU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|