C14H20Cl2N2O — CID 106712393
6-(3,5-dichlorophenoxy)-2,2-dimethylhexanimidamide (PubChem CID 106712393) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 6-(3,5-dichlorophenoxy)-2,2-dimethylhexanimidamide.
| Compound Name | 6-(3,5-dichlorophenoxy)-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106712393 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 6-(3,5-dichlorophenoxy)-2,2-dimethylhexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCOc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2N2O/c1-14(2,13(17)18)5-3-4-6-19-12-8-10(15)7-11(16)9-12/h7-9H,3-6H2,1-2H3,(H3,17,18) |
| InChIKey | MVANRBKWAKAMPL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|