C13H18Cl2N2O — CID 65258017
5-(3,4-dichlorophenoxy)-2,2-dimethylpentanimidamide (PubChem CID 65258017) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is 5-(3,4-dichlorophenoxy)-2,2-dimethylpentanimidamide.
| Compound Name | 5-(3,4-dichlorophenoxy)-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 65258017 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 5-(3,4-dichlorophenoxy)-2,2-dimethylpentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCOc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O/c1-13(2,12(16)17)6-3-7-18-9-4-5-10(14)11(15)8-9/h4-5,8H,3,6-7H2,1-2H3,(H3,16,17) |
| InChIKey | IBXQIRHESUAYQT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|