C14H21ClN2O — CID 106712293
6-(3-chlorophenoxy)-2,2-dimethylhexanimidamide (PubChem CID 106712293) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 6-(3-chlorophenoxy)-2,2-dimethylhexanimidamide.
| Compound Name | 6-(3-chlorophenoxy)-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106712293 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 6-(3-chlorophenoxy)-2,2-dimethylhexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H21ClN2O/c1-14(2,13(16)17)8-3-4-9-18-12-7-5-6-11(15)10-12/h5-7,10H,3-4,8-9H2,1-2H3,(H3,16,17) |
| InChIKey | SJDLLRIXRVEPFY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|