C16H26N2O — CID 65258501
2,2-dimethyl-5-(3-propan-2-ylphenoxy)pentanimidamide (PubChem CID 65258501) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-propan-2-ylphenoxy)pentanimidamide.
| Compound Name | 2,2-dimethyl-5-(3-propan-2-ylphenoxy)pentanimidamide |
|---|---|
| PubChem CID | 65258501 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2,2-dimethyl-5-(3-propan-2-ylphenoxy)pentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCOc1cccc(C(C)C)c1 |
| InChI | InChI=1S/C16H26N2O/c1-12(2)13-7-5-8-14(11-13)19-10-6-9-16(3,4)15(17)18/h5,7-8,11-12H,6,9-10H2,1-4H3,(H3,17,18) |
| InChIKey | SDAGVWNFUHSGAI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|