C15H24N2O2 — CID 106712416
6-[4-(hydroxymethyl)phenoxy]-2,2-dimethylhexanimidamide (PubChem CID 106712416) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 6-[4-(hydroxymethyl)phenoxy]-2,2-dimethylhexanimidamide.
| Compound Name | 6-[4-(hydroxymethyl)phenoxy]-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106712416 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 6-[4-(hydroxymethyl)phenoxy]-2,2-dimethylhexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCOc1ccc(CO)cc1 |
| InChI | InChI=1S/C15H24N2O2/c1-15(2,14(16)17)9-3-4-10-19-13-7-5-12(11-18)6-8-13/h5-8,18H,3-4,9-11H2,1-2H3,(H3,16,17) |
| InChIKey | VGCSSJAAJJHEDE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 79.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|