C15H14Cl2N2O2 — CID 61301174
4-[2-(3,4-dichlorophenoxy)ethoxy]benzenecarboximidamide (PubChem CID 61301174) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.20 g/mol. Its IUPAC name is 4-[2-(3,4-dichlorophenoxy)ethoxy]benzenecarboximidamide.
| Compound Name | 4-[2-(3,4-dichlorophenoxy)ethoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 61301174 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-[2-(3,4-dichlorophenoxy)ethoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCOc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H14Cl2N2O2/c16-13-6-5-12(9-14(13)17)21-8-7-20-11-3-1-10(2-4-11)15(18)19/h1-6,9H,7-8H2,(H3,18,19) |
| InChIKey | NQXGNKRXPGDZED-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|