C17H16Cl4O2 — CID 59168458
1,3-dichloro-5-[5-(3,5-dichlorophenoxy)pentoxy]benzene (PubChem CID 59168458) has the molecular formula C17H16Cl4O2 and a molecular weight of 394.13 g/mol. Its IUPAC name is 1,3-dichloro-5-[5-(3,5-dichlorophenoxy)pentoxy]benzene.
| Compound Name | 1,3-dichloro-5-[5-(3,5-dichlorophenoxy)pentoxy]benzene |
|---|---|
| PubChem CID | 59168458 |
| Molecular Formula | C17H16Cl4O2 |
| Molecular Weight | 394.13 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 1,3-dichloro-5-[5-(3,5-dichlorophenoxy)pentoxy]benzene |
| SMILES | Clc1cc(Cl)cc(OCCCCCOc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C17H16Cl4O2/c18-12-6-13(19)9-16(8-12)22-4-2-1-3-5-23-17-10-14(20)7-15(21)11-17/h6-11H,1-5H2 |
| InChIKey | ZORNTTRZUKYJFW-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.13 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|