C22H28N2O10 — CID 175836970
[4-[2-[2-[2-(3,5-dimethyl-4-nitrooxyphenoxy)ethoxy]ethoxy]ethoxy]-2,6-dimethylphenyl] nitrate (PubChem CID 175836970) has the molecular formula C22H28N2O10 and a molecular weight of 480.47 g/mol. Its IUPAC name is [4-[2-[2-[2-(3,5-dimethyl-4-nitrooxyphenoxy)ethoxy]ethoxy]ethoxy]-2,6-dimethylphenyl] nitrate.
| Compound Name | [4-[2-[2-[2-(3,5-dimethyl-4-nitrooxyphenoxy)ethoxy]ethoxy]ethoxy]-2,6-dimethylphenyl] nitrate |
|---|---|
| PubChem CID | 175836970 |
| Molecular Formula | C22H28N2O10 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [4-[2-[2-[2-(3,5-dimethyl-4-nitrooxyphenoxy)ethoxy]ethoxy]ethoxy]-2,6-dimethylphenyl] nitrate |
| SMILES | Cc1cc(OCCOCCOCCOc2cc(C)c(O[N+](=O)[O-])c(C)c2)cc(C)c1O[N+](=O)[O-] |
| InChI | InChI=1S/C22H28N2O10/c1-15-11-19(12-16(2)21(15)33-23(25)26)31-9-7-29-5-6-30-8-10-32-20-13-17(3)22(18(4)14-20)34-24(27)28/h11-14H,5-10H2,1-4H3 |
| InChIKey | IJEDEMQBTZVYJU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 141.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|