C8H9F2NO2S — CID 166140237
N-(3,5-difluoro-4-methylphenyl)methanesulfonamide (PubChem CID 166140237) has the molecular formula C8H9F2NO2S and a molecular weight of 221.23 g/mol. Its IUPAC name is N-(3,5-difluoro-4-methylphenyl)methanesulfonamide.
| Compound Name | N-(3,5-difluoro-4-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 166140237 |
| Molecular Formula | C8H9F2NO2S |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | N-(3,5-difluoro-4-methylphenyl)methanesulfonamide |
| SMILES | Cc1c(F)cc(NS(C)(=O)=O)cc1F |
| InChI | InChI=1S/C8H9F2NO2S/c1-5-7(9)3-6(4-8(5)10)11-14(2,12)13/h3-4,11H,1-2H3 |
| InChIKey | LYJNZIZQSKYEPB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |