C15H11F6NO4S2 — CID 26950039
N-(4-methylsulfonylphenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 26950039) has the molecular formula C15H11F6NO4S2 and a molecular weight of 447.38 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(4-methylsulfonylphenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 26950039 |
| Molecular Formula | C15H11F6NO4S2 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-3,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(NS(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H11F6NO4S2/c1-27(23,24)12-4-2-11(3-5-12)22-28(25,26)13-7-9(14(16,17)18)6-10(8-13)15(19,20)21/h2-8,22H,1H3 |
| InChIKey | CUXPKEDWVKBSOP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |