C13H8F5NO2S — CID 26970283
3,5-difluoro-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 26970283) has the molecular formula C13H8F5NO2S and a molecular weight of 337.27 g/mol. Its IUPAC name is 3,5-difluoro-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 3,5-difluoro-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26970283 |
| Molecular Formula | C13H8F5NO2S |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 3,5-difluoro-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(C(F)(F)F)cc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H8F5NO2S/c14-9-5-10(15)7-12(6-9)22(20,21)19-11-3-1-8(2-4-11)13(16,17)18/h1-7,19H |
| InChIKey | RMRIAQTZDQEWPE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |