About N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide
N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide (PubChem CID 3781466) has the molecular formula C16H11ClF6N2O3S
and a molecular weight of 460.78 g/mol. Its IUPAC name is N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide |
| PubChem CID | 3781466 |
| Molecular Formula | C16H11ClF6N2O3S |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NS(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1Cl |
| InChI | InChI=1S/C16H11ClF6N2O3S/c1-8(26)24-14-3-2-11(7-13(14)17)25-29(27,28)12-5-9(15(18,19)20)4-10(6-12)16(21,22)23/h2-7,25H,1H3,(H,24,26) |
| InChIKey | GRBHALWGPACRSA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide?
The IUPAC name of N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide (CID 3781466) is N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide.
What is the SMILES notation for N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide?
The canonical SMILES for N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide is CC(=O)Nc1ccc(NS(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1Cl.
What is the InChIKey of N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide?
The InChIKey is GRBHALWGPACRSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClF6N2O3S/c1-8(26)24-14-3-2-11(7-13(14)17)25-29(27,28)12-5-9(15(18,19)20)4-10(6-12)16(21,22)23/h2-7,25H,1H3,(H,24,26).
What are the key properties of N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide?
N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide has a molecular weight of 460.78 g/mol, XLogP of 5.14, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-2-chlorophenyl]acetamide is sourced from PubChem (CID 3781466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).