C13H15FN2O2S2 — CID 107429534
N-(3-fluoro-4-methylphenyl)-2-(methylaminomethyl)thiophene-3-sulfonamide (PubChem CID 107429534) has the molecular formula C13H15FN2O2S2 and a molecular weight of 314.41 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-2-(methylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-2-(methylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 107429534 |
| Molecular Formula | C13H15FN2O2S2 |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-2-(methylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CNCc1sccc1S(=O)(=O)Nc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C13H15FN2O2S2/c1-9-3-4-10(7-11(9)14)16-20(17,18)13-5-6-19-12(13)8-15-2/h3-7,15-16H,8H2,1-2H3 |
| InChIKey | IZDWPQITWHNVDM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |