C12H12Cl2N2O2S2 — CID 106059497
N-(3,4-dichlorophenyl)-2-(methylaminomethyl)thiophene-3-sulfonamide (PubChem CID 106059497) has the molecular formula C12H12Cl2N2O2S2 and a molecular weight of 351.28 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-(methylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-(methylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106059497 |
| Molecular Formula | C12H12Cl2N2O2S2 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-(methylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CNCc1sccc1S(=O)(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N2O2S2/c1-15-7-11-12(4-5-19-11)20(17,18)16-8-2-3-9(13)10(14)6-8/h2-6,15-16H,7H2,1H3 |
| InChIKey | BPVJSUJCMPNXRY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |