C10H12N4O2S2 — CID 106088650
2-(methylaminomethyl)-N-pyrimidin-5-ylthiophene-3-sulfonamide (PubChem CID 106088650) has the molecular formula C10H12N4O2S2 and a molecular weight of 284.37 g/mol. Its IUPAC name is 2-(methylaminomethyl)-N-pyrimidin-5-ylthiophene-3-sulfonamide.
| Compound Name | 2-(methylaminomethyl)-N-pyrimidin-5-ylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106088650 |
| Molecular Formula | C10H12N4O2S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-(methylaminomethyl)-N-pyrimidin-5-ylthiophene-3-sulfonamide |
| SMILES | CNCc1sccc1S(=O)(=O)Nc1cncnc1 |
| InChI | InChI=1S/C10H12N4O2S2/c1-11-6-9-10(2-3-17-9)18(15,16)14-8-4-12-7-13-5-8/h2-5,7,11,14H,6H2,1H3 |
| InChIKey | PMKFYYJENJIXFA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |