C12H22N2O2S2 — CID 114174631
2-(methylaminomethyl)-N-(3-methylpentan-3-yl)thiophene-3-sulfonamide (PubChem CID 114174631) has the molecular formula C12H22N2O2S2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-(methylaminomethyl)-N-(3-methylpentan-3-yl)thiophene-3-sulfonamide.
| Compound Name | 2-(methylaminomethyl)-N-(3-methylpentan-3-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114174631 |
| Molecular Formula | C12H22N2O2S2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(methylaminomethyl)-N-(3-methylpentan-3-yl)thiophene-3-sulfonamide |
| SMILES | CCC(C)(CC)NS(=O)(=O)c1ccsc1CNC |
| InChI | InChI=1S/C12H22N2O2S2/c1-5-12(3,6-2)14-18(15,16)11-7-8-17-10(11)9-13-4/h7-8,13-14H,5-6,9H2,1-4H3 |
| InChIKey | NQKZCALVOWVCSK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |