C11H20N2O2S2 — CID 114141131
2-(methylaminomethyl)-N-(3-methylbutyl)thiophene-3-sulfonamide (PubChem CID 114141131) has the molecular formula C11H20N2O2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 2-(methylaminomethyl)-N-(3-methylbutyl)thiophene-3-sulfonamide.
| Compound Name | 2-(methylaminomethyl)-N-(3-methylbutyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114141131 |
| Molecular Formula | C11H20N2O2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(methylaminomethyl)-N-(3-methylbutyl)thiophene-3-sulfonamide |
| SMILES | CNCc1sccc1S(=O)(=O)NCCC(C)C |
| InChI | InChI=1S/C11H20N2O2S2/c1-9(2)4-6-13-17(14,15)11-5-7-16-10(11)8-12-3/h5,7,9,12-13H,4,6,8H2,1-3H3 |
| InChIKey | LSLTZSWHIZBWSC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |