C11H21N3O2S2 — CID 114132383
N-[3-(dimethylamino)propyl]-2-(methylaminomethyl)thiophene-3-sulfonamide (PubChem CID 114132383) has the molecular formula C11H21N3O2S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(methylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-(methylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114132383 |
| Molecular Formula | C11H21N3O2S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(methylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CNCc1sccc1S(=O)(=O)NCCCN(C)C |
| InChI | InChI=1S/C11H21N3O2S2/c1-12-9-10-11(5-8-17-10)18(15,16)13-6-4-7-14(2)3/h5,8,12-13H,4,6-7,9H2,1-3H3 |
| InChIKey | KLFACUCNWQBBTC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|