C11H17F3N2O2S2 — CID 115522943
2-(methylaminomethyl)-N-(5,5,5-trifluoropentyl)thiophene-3-sulfonamide (PubChem CID 115522943) has the molecular formula C11H17F3N2O2S2 and a molecular weight of 330.40 g/mol. Its IUPAC name is 2-(methylaminomethyl)-N-(5,5,5-trifluoropentyl)thiophene-3-sulfonamide.
| Compound Name | 2-(methylaminomethyl)-N-(5,5,5-trifluoropentyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 115522943 |
| Molecular Formula | C11H17F3N2O2S2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-(methylaminomethyl)-N-(5,5,5-trifluoropentyl)thiophene-3-sulfonamide |
| SMILES | CNCc1sccc1S(=O)(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O2S2/c1-15-8-9-10(4-7-19-9)20(17,18)16-6-3-2-5-11(12,13)14/h4,7,15-16H,2-3,5-6,8H2,1H3 |
| InChIKey | RVECMHZYQOGPNN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|