C11H19NO3S3 — CID 106002506
2-(hydroxymethyl)-N-(5-methylsulfanylpentyl)thiophene-3-sulfonamide (PubChem CID 106002506) has the molecular formula C11H19NO3S3 and a molecular weight of 309.48 g/mol. Its IUPAC name is 2-(hydroxymethyl)-N-(5-methylsulfanylpentyl)thiophene-3-sulfonamide.
| Compound Name | 2-(hydroxymethyl)-N-(5-methylsulfanylpentyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106002506 |
| Molecular Formula | C11H19NO3S3 |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-(hydroxymethyl)-N-(5-methylsulfanylpentyl)thiophene-3-sulfonamide |
| SMILES | CSCCCCCNS(=O)(=O)c1ccsc1CO |
| InChI | InChI=1S/C11H19NO3S3/c1-16-7-4-2-3-6-12-18(14,15)11-5-8-17-10(11)9-13/h5,8,12-13H,2-4,6-7,9H2,1H3 |
| InChIKey | PVFFMZYXLXZBNT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|