C9H13F2NO4S2 — CID 106001559
N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)thiophene-3-sulfonamide (PubChem CID 106001559) has the molecular formula C9H13F2NO4S2 and a molecular weight of 301.34 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)thiophene-3-sulfonamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106001559 |
| Molecular Formula | C9H13F2NO4S2 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-(hydroxymethyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCCOCC(F)F)c1ccsc1CO |
| InChI | InChI=1S/C9H13F2NO4S2/c10-9(11)6-16-3-2-12-18(14,15)8-1-4-17-7(8)5-13/h1,4,9,12-13H,2-3,5-6H2 |
| InChIKey | ZLUAKNBUAWQXRL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|