C11H17F3N2O3S2 — CID 106064642
2-(ethylaminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-3-sulfonamide (PubChem CID 106064642) has the molecular formula C11H17F3N2O3S2 and a molecular weight of 346.40 g/mol. Its IUPAC name is 2-(ethylaminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-3-sulfonamide.
| Compound Name | 2-(ethylaminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106064642 |
| Molecular Formula | C11H17F3N2O3S2 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-(ethylaminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-3-sulfonamide |
| SMILES | CCNCc1sccc1S(=O)(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O3S2/c1-2-15-7-9-10(3-6-20-9)21(17,18)16-4-5-19-8-11(12,13)14/h3,6,15-16H,2,4-5,7-8H2,1H3 |
| InChIKey | NKJMCFKKZXJOBR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|