C12H18N4O2S2 — CID 106066571
2-(ethylaminomethyl)-N-[2-(1H-imidazol-5-yl)ethyl]thiophene-3-sulfonamide (PubChem CID 106066571) has the molecular formula C12H18N4O2S2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 2-(ethylaminomethyl)-N-[2-(1H-imidazol-5-yl)ethyl]thiophene-3-sulfonamide.
| Compound Name | 2-(ethylaminomethyl)-N-[2-(1H-imidazol-5-yl)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106066571 |
| Molecular Formula | C12H18N4O2S2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-(ethylaminomethyl)-N-[2-(1H-imidazol-5-yl)ethyl]thiophene-3-sulfonamide |
| SMILES | CCNCc1sccc1S(=O)(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C12H18N4O2S2/c1-2-13-8-11-12(4-6-19-11)20(17,18)16-5-3-10-7-14-9-15-10/h4,6-7,9,13,16H,2-3,5,8H2,1H3,(H,14,15) |
| InChIKey | VQQABRVUSNDMEF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |