C10H20N4O2S — CID 106066548
3-(ethylamino)-N-[2-(1H-imidazol-5-yl)ethyl]propane-1-sulfonamide (PubChem CID 106066548) has the molecular formula C10H20N4O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is 3-(ethylamino)-N-[2-(1H-imidazol-5-yl)ethyl]propane-1-sulfonamide.
| Compound Name | 3-(ethylamino)-N-[2-(1H-imidazol-5-yl)ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 106066548 |
| Molecular Formula | C10H20N4O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-(ethylamino)-N-[2-(1H-imidazol-5-yl)ethyl]propane-1-sulfonamide |
| SMILES | CCNCCCS(=O)(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C10H20N4O2S/c1-2-11-5-3-7-17(15,16)14-6-4-10-8-12-9-13-10/h8-9,11,14H,2-7H2,1H3,(H,12,13) |
| InChIKey | ZEOCYAZOYGGHFW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|